| Product name: | Isopropylurea |
| CAS NO.: | 691-60-1 |
| EINECS NO: | 211-722-2 |
| InChi: | InChI=1/C4H10N2O/c1-3(2)6-4(5)7/h3H,1-2H3,(H3,5,6,7) |
| Formula: | C4H10N2O |
| MWt: | 102.135 |
| Purity: | 98%min |
| Grade standard: | Medicine Grade |
| Appearance: | liquid |
| Density: | 0.976g/cm3 |
| Boiling point: | 149.3ºC at 760 mmHg |
| Refractive index: | 1.442 |
| Flash point: | 44.1°C |
| Vapor pressure: | 4.06mmHg at 25°C |
| Packing: | According to the needs of customers |
| Storagy: | Sealed dark storage |
Telephone：+86-21-61984905 ext 1、ext 2
E-mail：sales@synchem-pharma.com
Company：Shanghai Synchem Pharma Co.,Ltd
Address：Building 60,Zimian Park, LongYang industrial Area,
1515Nong,Yuandong Road,Fengxian District,
Shanghai ,China 201401