| Product name: | trans-Styrylacetic acid |
| CAS NO.: | 1914-58-5 |
| EINECS NO: | 218-814-1 |
| InChi: | InChI=1/C10H10O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-7H,8H2,(H,11,12)/p-1/b7-4+ |
| Formula: | C10H10O2 |
| MWt: | 161.1778 |
| Purity: | 98%min |
| Appearance: | White or yellow crystalline powder |
| Density: | 1.145 g/cm3 |
| Melting point: | 82-88℃ |
| Boiling point: | 302°C at 760 mmHg |
| Flansh point: | 215.8°C |
| Vapor pressure: | 0.00045mmHg at 25°C |
|
Packing:
|
According to the needs of customers |
| Storagy: | Sealed storage in a cool dry place |
Telephone：+86-21-61984905 ext 1、ext 2
E-mail：sales@synchem-pharma.com
Company：Shanghai Synchem Pharma Co.,Ltd
Address：Building 60,Zimian Park, LongYang industrial Area,
1515Nong,Yuandong Road,Fengxian District,
Shanghai ,China 201401