| Product name: | Temoporfin |
| CAS NO.: | 122341-38-2 |
| InChi: | InChI=1/C44H32N4O4/c49-29-9-1-5-25(21-29)41-33-13-15-35(45-33)42(26-6-2-10-30(50)22-26)37-17-19-39(47-37)44(28-8-4-12-32(52)24-28)40-20-18-38(48-40)43(36-16-14-34(41)46-36)27-7-3-11-31(51)23-27/h1-17,19,21-24,46-47,49-52H,18,20H2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| Formula: | C44H32N4O4 |
| MWt: | 680.761 |
| Purity: | 98% |
| Appearance: | Purple powder |
| Density: | 1.386g/cm3 |
| Packing: | According to the needs of customers |
| Storagy: | Store in a tightly sealed container under -20°C. Keep away from heat and direct sunlight |

Telephone:+86-21-61984905 ext 1、ext 2
E-mail:sales@synchem-pharma.com
Company:Shanghai Synchem Pharma Co.,Ltd
Address:Building 60,Zimian Park, LongYang industrial Area,
1515Nong,Yuandong Road,Fengxian District,
Shanghai ,China 201401