| Product name: | Fmoc-L-2-cyanophenylalanine |
| CAS NO.: | 401933-16-2 |
| InChi: | InChI=1/C25H20N2O4/c26-14-17-8-2-1-7-16(17)13-23(24(28)29)27-25(30)31-15-22-20-11-5-3-9-18(20)19-10-4-6-12-21(19)22/h1-12,22-23H,13,15H2,(H,27,30)(H,28,29)/t23-/m1/s1 |
| Formula: | C25H20N2O4 |
| MWt: | 412.4373 |
| Purity: | 97%min |
| Grade standard: | Medicine Grade |
| Appearance: | White powder |
| Density: | 1.35g/cm3 |
| Boiling point: | 666°C at 760 mmHg |
| Refractive index: | 1.672 |
| Flash point: | 356.6°C |
| Vapor pressure: | 1.2E-18mmHg at 25°C |
| Packing: | According to the needs of customers |
| Storagy: | Sealed storage in a cool dry and ventilated place |

Telephone:+86-21-61984905 ext 1、ext 2
E-mail:sales@synchem-pharma.com
Company:Shanghai Synchem Pharma Co.,Ltd
Address:Building 60,Zimian Park, LongYang industrial Area,
1515Nong,Yuandong Road,Fengxian District,
Shanghai ,China 201401